C12H19ClN2 — CID 60888732
N'-[1-(4-chlorophenyl)butyl]ethane-1,2-diamine (PubChem CID 60888732) has the molecular formula C12H19ClN2 and a molecular weight of 226.75 g/mol. Its IUPAC name is N'-[1-(4-chlorophenyl)butyl]ethane-1,2-diamine.
| Compound Name | N'-[1-(4-chlorophenyl)butyl]ethane-1,2-diamine |
|---|---|
| PubChem CID | 60888732 |
| Molecular Formula | C12H19ClN2 |
| Molecular Weight | 226.75 g/mol |
| Exact Mass | 226.12 |
| IUPAC Name | N'-[1-(4-chlorophenyl)butyl]ethane-1,2-diamine |
| SMILES | CCCC(NCCN)c1ccc(Cl)cc1 |
| InChI | InChI=1S/C12H19ClN2/c1-2-3-12(15-9-8-14)10-4-6-11(13)7-5-10/h4-7,12,15H,2-3,8-9,14H2,1H3 |
| InChIKey | XNBURXQUKHWHDI-UHFFFAOYSA-N |
| XLogP | 2.73 |
| TPSA | 38.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 226.75 |
| LogP ≤ 5 | 2.73 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |