C16H21NO2S2 — CID 64645998
N-methyl-1-(4-propylphenyl)-2-thiophen-2-ylsulfonylethanamine (PubChem CID 64645998) has the molecular formula C16H21NO2S2 and a molecular weight of 323.48 g/mol. Its IUPAC name is N-methyl-1-(4-propylphenyl)-2-thiophen-2-ylsulfonylethanamine.
| Compound Name | N-methyl-1-(4-propylphenyl)-2-thiophen-2-ylsulfonylethanamine |
|---|---|
| PubChem CID | 64645998 |
| Molecular Formula | C16H21NO2S2 |
| Molecular Weight | 323.48 g/mol |
| Exact Mass | 323.10 |
| IUPAC Name | N-methyl-1-(4-propylphenyl)-2-thiophen-2-ylsulfonylethanamine |
| SMILES | CCCc1ccc(C(CS(=O)(=O)c2cccs2)NC)cc1 |
| InChI | InChI=1S/C16H21NO2S2/c1-3-5-13-7-9-14(10-8-13)15(17-2)12-21(18,19)16-6-4-11-20-16/h4,6-11,15,17H,3,5,12H2,1-2H3 |
| InChIKey | OKQWBWXPRBBVBK-UHFFFAOYSA-N |
| XLogP | 3.43 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.48 |
| LogP ≤ 5 | 3.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |