C17H21NO4S2 — CID 9182900
N-[(2S)-2-(4-methoxyphenyl)-2-thiophen-2-ylsulfonylethyl]butanamide (PubChem CID 9182900) has the molecular formula C17H21NO4S2 and a molecular weight of 367.49 g/mol. Its IUPAC name is N-[(2S)-2-(4-methoxyphenyl)-2-thiophen-2-ylsulfonylethyl]butanamide.
| Compound Name | N-[(2S)-2-(4-methoxyphenyl)-2-thiophen-2-ylsulfonylethyl]butanamide |
|---|---|
| PubChem CID | 9182900 |
| Molecular Formula | C17H21NO4S2 |
| Molecular Weight | 367.49 g/mol |
| Exact Mass | 367.09 |
| IUPAC Name | N-[(2S)-2-(4-methoxyphenyl)-2-thiophen-2-ylsulfonylethyl]butanamide |
| SMILES | CCCC(=O)NC[C@H](c1ccc(OC)cc1)S(=O)(=O)c1cccs1 |
| InChI | InChI=1S/C17H21NO4S2/c1-3-5-16(19)18-12-15(13-7-9-14(22-2)10-8-13)24(20,21)17-6-4-11-23-17/h4,6-11,15H,3,5,12H2,1-2H3,(H,18,19)/t15-/m1/s1 |
| InChIKey | VKBVNZJLJXQUJD-OAHLLOKOSA-N |
| XLogP | 3.19 |
| TPSA | 72.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.49 |
| LogP ≤ 5 | 3.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |