C20H19NO4S2 — CID 9180474
2-phenoxy-N-[(2S)-2-phenyl-2-thiophen-2-ylsulfonylethyl]acetamide (PubChem CID 9180474) has the molecular formula C20H19NO4S2 and a molecular weight of 401.51 g/mol. Its IUPAC name is 2-phenoxy-N-[(2S)-2-phenyl-2-thiophen-2-ylsulfonylethyl]acetamide.
| Compound Name | 2-phenoxy-N-[(2S)-2-phenyl-2-thiophen-2-ylsulfonylethyl]acetamide |
|---|---|
| PubChem CID | 9180474 |
| Molecular Formula | C20H19NO4S2 |
| Molecular Weight | 401.51 g/mol |
| Exact Mass | 401.08 |
| IUPAC Name | 2-phenoxy-N-[(2S)-2-phenyl-2-thiophen-2-ylsulfonylethyl]acetamide |
| SMILES | O=C(COc1ccccc1)NC[C@H](c1ccccc1)S(=O)(=O)c1cccs1 |
| InChI | InChI=1S/C20H19NO4S2/c22-19(15-25-17-10-5-2-6-11-17)21-14-18(16-8-3-1-4-9-16)27(23,24)20-12-7-13-26-20/h1-13,18H,14-15H2,(H,21,22)/t18-/m1/s1 |
| InChIKey | SYRUMHQGFHGEFL-GOSISDBHSA-N |
| XLogP | 3.46 |
| TPSA | 72.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.51 |
| LogP ≤ 5 | 3.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |