C19H19NO4S3 — CID 22584107
2-(4-methoxyphenyl)-N-(2-thiophen-2-yl-2-thiophen-2-ylsulfonylethyl)acetamide (PubChem CID 22584107) has the molecular formula C19H19NO4S3 and a molecular weight of 421.57 g/mol. Its IUPAC name is 2-(4-methoxyphenyl)-N-(2-thiophen-2-yl-2-thiophen-2-ylsulfonylethyl)acetamide.
| Compound Name | 2-(4-methoxyphenyl)-N-(2-thiophen-2-yl-2-thiophen-2-ylsulfonylethyl)acetamide |
|---|---|
| PubChem CID | 22584107 |
| Molecular Formula | C19H19NO4S3 |
| Molecular Weight | 421.57 g/mol |
| Exact Mass | 421.05 |
| IUPAC Name | 2-(4-methoxyphenyl)-N-(2-thiophen-2-yl-2-thiophen-2-ylsulfonylethyl)acetamide |
| SMILES | COc1ccc(CC(=O)NCC(c2cccs2)S(=O)(=O)c2cccs2)cc1 |
| InChI | InChI=1S/C19H19NO4S3/c1-24-15-8-6-14(7-9-15)12-18(21)20-13-17(16-4-2-10-25-16)27(22,23)19-5-3-11-26-19/h2-11,17H,12-13H2,1H3,(H,20,21) |
| InChIKey | VJZYBQXVSVBMMG-UHFFFAOYSA-N |
| XLogP | 3.69 |
| TPSA | 72.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.57 |
| LogP ≤ 5 | 3.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |