C15H16ClNO4S2 — CID 9183001
2-chloro-N-[(2R)-2-(4-methoxyphenyl)-2-thiophen-2-ylsulfonylethyl]acetamide (PubChem CID 9183001) has the molecular formula C15H16ClNO4S2 and a molecular weight of 373.88 g/mol. Its IUPAC name is 2-chloro-N-[(2R)-2-(4-methoxyphenyl)-2-thiophen-2-ylsulfonylethyl]acetamide.
| Compound Name | 2-chloro-N-[(2R)-2-(4-methoxyphenyl)-2-thiophen-2-ylsulfonylethyl]acetamide |
|---|---|
| PubChem CID | 9183001 |
| Molecular Formula | C15H16ClNO4S2 |
| Molecular Weight | 373.88 g/mol |
| Exact Mass | 373.02 |
| IUPAC Name | 2-chloro-N-[(2R)-2-(4-methoxyphenyl)-2-thiophen-2-ylsulfonylethyl]acetamide |
| SMILES | COc1ccc([C@H](CNC(=O)CCl)S(=O)(=O)c2cccs2)cc1 |
| InChI | InChI=1S/C15H16ClNO4S2/c1-21-12-6-4-11(5-7-12)13(10-17-14(18)9-16)23(19,20)15-3-2-8-22-15/h2-8,13H,9-10H2,1H3,(H,17,18)/t13-/m0/s1 |
| InChIKey | HAVLHEBDZOMWDU-ZDUSSCGKSA-N |
| XLogP | 2.63 |
| TPSA | 72.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.88 |
| LogP ≤ 5 | 2.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|