C19H26N2O3S2 — CID 9158948
N-[(2R)-2-[4-(dimethylamino)phenyl]-2-thiophen-2-ylsulfonylethyl]-3-methylbutanamide (PubChem CID 9158948) has the molecular formula C19H26N2O3S2 and a molecular weight of 394.56 g/mol. Its IUPAC name is N-[(2R)-2-[4-(dimethylamino)phenyl]-2-thiophen-2-ylsulfonylethyl]-3-methylbutanamide.
| Compound Name | N-[(2R)-2-[4-(dimethylamino)phenyl]-2-thiophen-2-ylsulfonylethyl]-3-methylbutanamide |
|---|---|
| PubChem CID | 9158948 |
| Molecular Formula | C19H26N2O3S2 |
| Molecular Weight | 394.56 g/mol |
| Exact Mass | 394.14 |
| IUPAC Name | N-[(2R)-2-[4-(dimethylamino)phenyl]-2-thiophen-2-ylsulfonylethyl]-3-methylbutanamide |
| SMILES | CC(C)CC(=O)NC[C@@H](c1ccc(N(C)C)cc1)S(=O)(=O)c1cccs1 |
| InChI | InChI=1S/C19H26N2O3S2/c1-14(2)12-18(22)20-13-17(26(23,24)19-6-5-11-25-19)15-7-9-16(10-8-15)21(3)4/h5-11,14,17H,12-13H2,1-4H3,(H,20,22)/t17-/m0/s1 |
| InChIKey | GUPWUJNMNYDTIR-KRWDZBQOSA-N |
| XLogP | 3.49 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.56 |
| LogP ≤ 5 | 3.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'} |
|---|