C19H17ClN2O4S2 — CID 40903674
2-(4-chlorophenoxy)-N-[(2R)-2-pyridin-3-yl-2-thiophen-2-ylsulfonylethyl]acetamide (PubChem CID 40903674) has the molecular formula C19H17ClN2O4S2 and a molecular weight of 436.94 g/mol. Its IUPAC name is 2-(4-chlorophenoxy)-N-[(2R)-2-pyridin-3-yl-2-thiophen-2-ylsulfonylethyl]acetamide.
| Compound Name | 2-(4-chlorophenoxy)-N-[(2R)-2-pyridin-3-yl-2-thiophen-2-ylsulfonylethyl]acetamide |
|---|---|
| PubChem CID | 40903674 |
| Molecular Formula | C19H17ClN2O4S2 |
| Molecular Weight | 436.94 g/mol |
| Exact Mass | 436.03 |
| IUPAC Name | 2-(4-chlorophenoxy)-N-[(2R)-2-pyridin-3-yl-2-thiophen-2-ylsulfonylethyl]acetamide |
| SMILES | O=C(COc1ccc(Cl)cc1)NC[C@@H](c1cccnc1)S(=O)(=O)c1cccs1 |
| InChI | InChI=1S/C19H17ClN2O4S2/c20-15-5-7-16(8-6-15)26-13-18(23)22-12-17(14-3-1-9-21-11-14)28(24,25)19-4-2-10-27-19/h1-11,17H,12-13H2,(H,22,23)/t17-/m0/s1 |
| InChIKey | CEHHZKLUJYSVRM-KRWDZBQOSA-N |
| XLogP | 3.51 |
| TPSA | 85.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.94 |
| LogP ≤ 5 | 3.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |