C19H26N3O4S2+ — CID 9180999
dimethyl-[3-[[2-oxo-2-[[(2R)-2-phenyl-2-thiophen-2-ylsulfonylethyl]amino]acetyl]amino]propyl]azanium (PubChem CID 9180999) has the molecular formula C19H26N3O4S2+ and a molecular weight of 424.57 g/mol. Its IUPAC name is dimethyl-[3-[[2-oxo-2-[[(2R)-2-phenyl-2-thiophen-2-ylsulfonylethyl]amino]acetyl]amino]propyl]azanium.
| Compound Name | dimethyl-[3-[[2-oxo-2-[[(2R)-2-phenyl-2-thiophen-2-ylsulfonylethyl]amino]acetyl]amino]propyl]azanium |
|---|---|
| PubChem CID | 9180999 |
| Molecular Formula | C19H26N3O4S2+ |
| Molecular Weight | 424.57 g/mol |
| Exact Mass | 424.14 |
| IUPAC Name | dimethyl-[3-[[2-oxo-2-[[(2R)-2-phenyl-2-thiophen-2-ylsulfonylethyl]amino]acetyl]amino]propyl]azanium |
| SMILES | C[NH+](C)CCCNC(=O)C(=O)NC[C@@H](c1ccccc1)S(=O)(=O)c1cccs1 |
| InChI | InChI=1S/C19H25N3O4S2/c1-22(2)12-7-11-20-18(23)19(24)21-14-16(15-8-4-3-5-9-15)28(25,26)17-10-6-13-27-17/h3-6,8-10,13,16H,7,11-12,14H2,1-2H3,(H,20,23)(H,21,24)/p+1/t16-/m0/s1 |
| InChIKey | TXGGMQJQSXMHMK-INIZCTEOSA-O |
| XLogP | 0.03 |
| TPSA | 96.78 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.57 |
| LogP ≤ 5 | 0.03 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|