C21H22N2O5S2 — CID 27558122
N'-[(2S)-2-(furan-2-yl)-2-thiophen-2-ylsulfonylethyl]-N-(3-phenylpropyl)oxamide (PubChem CID 27558122) has the molecular formula C21H22N2O5S2 and a molecular weight of 446.55 g/mol. Its IUPAC name is N'-[(2S)-2-(furan-2-yl)-2-thiophen-2-ylsulfonylethyl]-N-(3-phenylpropyl)oxamide.
| Compound Name | N'-[(2S)-2-(furan-2-yl)-2-thiophen-2-ylsulfonylethyl]-N-(3-phenylpropyl)oxamide |
|---|---|
| PubChem CID | 27558122 |
| Molecular Formula | C21H22N2O5S2 |
| Molecular Weight | 446.55 g/mol |
| Exact Mass | 446.10 |
| IUPAC Name | N'-[(2S)-2-(furan-2-yl)-2-thiophen-2-ylsulfonylethyl]-N-(3-phenylpropyl)oxamide |
| SMILES | O=C(NCCCc1ccccc1)C(=O)NC[C@@H](c1ccco1)S(=O)(=O)c1cccs1 |
| InChI | InChI=1S/C21H22N2O5S2/c24-20(22-12-4-9-16-7-2-1-3-8-16)21(25)23-15-18(17-10-5-13-28-17)30(26,27)19-11-6-14-29-19/h1-3,5-8,10-11,13-14,18H,4,9,12,15H2,(H,22,24)(H,23,25)/t18-/m0/s1 |
| InChIKey | OHBPELYTYCLOIZ-SFHVURJKSA-N |
| XLogP | 2.72 |
| TPSA | 105.48 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.55 |
| LogP ≤ 5 | 2.72 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|