C22H21N3O5S2 — CID 22584662
N'-[2-(furan-2-yl)-2-thiophen-2-ylsulfonylethyl]-N-[2-(1H-indol-3-yl)ethyl]oxamide (PubChem CID 22584662) has the molecular formula C22H21N3O5S2 and a molecular weight of 471.56 g/mol. Its IUPAC name is N'-[2-(furan-2-yl)-2-thiophen-2-ylsulfonylethyl]-N-[2-(1H-indol-3-yl)ethyl]oxamide.
| Compound Name | N'-[2-(furan-2-yl)-2-thiophen-2-ylsulfonylethyl]-N-[2-(1H-indol-3-yl)ethyl]oxamide |
|---|---|
| PubChem CID | 22584662 |
| Molecular Formula | C22H21N3O5S2 |
| Molecular Weight | 471.56 g/mol |
| Exact Mass | 471.09 |
| IUPAC Name | N'-[2-(furan-2-yl)-2-thiophen-2-ylsulfonylethyl]-N-[2-(1H-indol-3-yl)ethyl]oxamide |
| SMILES | O=C(NCCc1c[nH]c2ccccc12)C(=O)NCC(c1ccco1)S(=O)(=O)c1cccs1 |
| InChI | InChI=1S/C22H21N3O5S2/c26-21(23-10-9-15-13-24-17-6-2-1-5-16(15)17)22(27)25-14-19(18-7-3-11-30-18)32(28,29)20-8-4-12-31-20/h1-8,11-13,19,24H,9-10,14H2,(H,23,26)(H,25,27) |
| InChIKey | PZDRGOVQJJKEHP-UHFFFAOYSA-N |
| XLogP | 2.81 |
| TPSA | 121.27 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 471.56 |
| LogP ≤ 5 | 2.81 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|