C17H16N2O5S — CID 17365887
N-[2-(1H-indol-3-yl)ethyl]thiophene-2-carboxamide;oxalic acid (PubChem CID 17365887) has the molecular formula C17H16N2O5S and a molecular weight of 360.39 g/mol. Its IUPAC name is N-[2-(1H-indol-3-yl)ethyl]thiophene-2-carboxamide;oxalic acid.
| Compound Name | N-[2-(1H-indol-3-yl)ethyl]thiophene-2-carboxamide;oxalic acid |
|---|---|
| PubChem CID | 17365887 |
| Molecular Formula | C17H16N2O5S |
| Molecular Weight | 360.39 g/mol |
| Exact Mass | 360.08 |
| IUPAC Name | N-[2-(1H-indol-3-yl)ethyl]thiophene-2-carboxamide;oxalic acid |
| SMILES | O=C(NCCc1c[nH]c2ccccc12)c1cccs1.O=C(O)C(=O)O |
| InChI | InChI=1S/C15H14N2OS.C2H2O4/c18-15(14-6-3-9-19-14)16-8-7-11-10-17-13-5-2-1-4-12(11)13;3-1(4)2(5)6/h1-6,9-10,17H,7-8H2,(H,16,18);(H,3,4)(H,5,6) |
| InChIKey | JIZHTVKBBXTQIQ-UHFFFAOYSA-N |
| XLogP | 2.36 |
| TPSA | 119.49 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.39 |
| LogP ≤ 5 | 2.36 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|