C21H18N2OS — CID 4880396
N-[2-(1H-indol-3-yl)-2-phenylethyl]thiophene-2-carboxamide (PubChem CID 4880396) has the molecular formula C21H18N2OS and a molecular weight of 346.46 g/mol. Its IUPAC name is N-[2-(1H-indol-3-yl)-2-phenylethyl]thiophene-2-carboxamide.
| Compound Name | N-[2-(1H-indol-3-yl)-2-phenylethyl]thiophene-2-carboxamide |
|---|---|
| PubChem CID | 4880396 |
| Molecular Formula | C21H18N2OS |
| Molecular Weight | 346.46 g/mol |
| Exact Mass | 346.11 |
| IUPAC Name | N-[2-(1H-indol-3-yl)-2-phenylethyl]thiophene-2-carboxamide |
| SMILES | O=C(NCC(c1ccccc1)c1c[nH]c2ccccc12)c1cccs1 |
| InChI | InChI=1S/C21H18N2OS/c24-21(20-11-6-12-25-20)23-13-17(15-7-2-1-3-8-15)18-14-22-19-10-5-4-9-16(18)19/h1-12,14,17,22H,13H2,(H,23,24) |
| InChIKey | OHCDEUBPASYAPI-UHFFFAOYSA-N |
| XLogP | 4.79 |
| TPSA | 44.89 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.46 |
| LogP ≤ 5 | 4.79 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |