C23H19ClN2O — CID 35130080
2-chloro-N-[(2R)-2-(1H-indol-3-yl)-2-phenylethyl]benzamide (PubChem CID 35130080) has the molecular formula C23H19ClN2O and a molecular weight of 374.87 g/mol. Its IUPAC name is 2-chloro-N-[(2R)-2-(1H-indol-3-yl)-2-phenylethyl]benzamide.
| Compound Name | 2-chloro-N-[(2R)-2-(1H-indol-3-yl)-2-phenylethyl]benzamide |
|---|---|
| PubChem CID | 35130080 |
| Molecular Formula | C23H19ClN2O |
| Molecular Weight | 374.87 g/mol |
| Exact Mass | 374.12 |
| IUPAC Name | 2-chloro-N-[(2R)-2-(1H-indol-3-yl)-2-phenylethyl]benzamide |
| SMILES | O=C(NC[C@H](c1ccccc1)c1c[nH]c2ccccc12)c1ccccc1Cl |
| InChI | InChI=1S/C23H19ClN2O/c24-21-12-6-4-11-18(21)23(27)26-14-19(16-8-2-1-3-9-16)20-15-25-22-13-7-5-10-17(20)22/h1-13,15,19,25H,14H2,(H,26,27)/t19-/m1/s1 |
| InChIKey | YEHGHCXFJMVDTB-LJQANCHMSA-N |
| XLogP | 5.38 |
| TPSA | 44.89 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.87 |
| LogP ≤ 5 | 5.38 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |