C23H18F2N2O — CID 26243582
2,4-difluoro-N-[(2R)-2-(1H-indol-3-yl)-2-phenylethyl]benzamide (PubChem CID 26243582) has the molecular formula C23H18F2N2O and a molecular weight of 376.41 g/mol. Its IUPAC name is 2,4-difluoro-N-[(2R)-2-(1H-indol-3-yl)-2-phenylethyl]benzamide.
| Compound Name | 2,4-difluoro-N-[(2R)-2-(1H-indol-3-yl)-2-phenylethyl]benzamide |
|---|---|
| PubChem CID | 26243582 |
| Molecular Formula | C23H18F2N2O |
| Molecular Weight | 376.41 g/mol |
| Exact Mass | 376.14 |
| IUPAC Name | 2,4-difluoro-N-[(2R)-2-(1H-indol-3-yl)-2-phenylethyl]benzamide |
| SMILES | O=C(NC[C@H](c1ccccc1)c1c[nH]c2ccccc12)c1ccc(F)cc1F |
| InChI | InChI=1S/C23H18F2N2O/c24-16-10-11-18(21(25)12-16)23(28)27-13-19(15-6-2-1-3-7-15)20-14-26-22-9-5-4-8-17(20)22/h1-12,14,19,26H,13H2,(H,27,28)/t19-/m1/s1 |
| InChIKey | XRUGWBYYIVRFJZ-LJQANCHMSA-N |
| XLogP | 5.01 |
| TPSA | 44.89 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.41 |
| LogP ≤ 5 | 5.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |