C26H25FN2O4 — CID 55512740
N-[2-(2,3-dimethoxyphenyl)-2-(1H-indol-3-yl)ethyl]-5-fluoro-2-methoxybenzamide (PubChem CID 55512740) has the molecular formula C26H25FN2O4 and a molecular weight of 448.49 g/mol. Its IUPAC name is N-[2-(2,3-dimethoxyphenyl)-2-(1H-indol-3-yl)ethyl]-5-fluoro-2-methoxybenzamide.
| Compound Name | N-[2-(2,3-dimethoxyphenyl)-2-(1H-indol-3-yl)ethyl]-5-fluoro-2-methoxybenzamide |
|---|---|
| PubChem CID | 55512740 |
| Molecular Formula | C26H25FN2O4 |
| Molecular Weight | 448.49 g/mol |
| Exact Mass | 448.18 |
| IUPAC Name | N-[2-(2,3-dimethoxyphenyl)-2-(1H-indol-3-yl)ethyl]-5-fluoro-2-methoxybenzamide |
| SMILES | COc1ccc(F)cc1C(=O)NCC(c1cccc(OC)c1OC)c1c[nH]c2ccccc12 |
| InChI | InChI=1S/C26H25FN2O4/c1-31-23-12-11-16(27)13-19(23)26(30)29-15-21(18-8-6-10-24(32-2)25(18)33-3)20-14-28-22-9-5-4-7-17(20)22/h4-14,21,28H,15H2,1-3H3,(H,29,30) |
| InChIKey | ISNCETSIGGDSBG-UHFFFAOYSA-N |
| XLogP | 4.89 |
| TPSA | 72.58 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 448.49 |
| LogP ≤ 5 | 4.89 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |