C26H24N4O3 — CID 60589031
N-[2-(2,3-dimethoxyphenyl)-2-(1H-indol-3-yl)ethyl]-1H-indazole-3-carboxamide (PubChem CID 60589031) has the molecular formula C26H24N4O3 and a molecular weight of 440.50 g/mol. Its IUPAC name is N-[2-(2,3-dimethoxyphenyl)-2-(1H-indol-3-yl)ethyl]-1H-indazole-3-carboxamide.
| Compound Name | N-[2-(2,3-dimethoxyphenyl)-2-(1H-indol-3-yl)ethyl]-1H-indazole-3-carboxamide |
|---|---|
| PubChem CID | 60589031 |
| Molecular Formula | C26H24N4O3 |
| Molecular Weight | 440.50 g/mol |
| Exact Mass | 440.18 |
| IUPAC Name | N-[2-(2,3-dimethoxyphenyl)-2-(1H-indol-3-yl)ethyl]-1H-indazole-3-carboxamide |
| SMILES | COc1cccc(C(CNC(=O)c2n[nH]c3ccccc23)c2c[nH]c3ccccc23)c1OC |
| InChI | InChI=1S/C26H24N4O3/c1-32-23-13-7-10-17(25(23)33-2)20(19-14-27-21-11-5-3-8-16(19)21)15-28-26(31)24-18-9-4-6-12-22(18)29-30-24/h3-14,20,27H,15H2,1-2H3,(H,28,31)(H,29,30) |
| InChIKey | ZZJRWJDWBZXCGT-UHFFFAOYSA-N |
| XLogP | 4.62 |
| TPSA | 92.03 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 440.50 |
| LogP ≤ 5 | 4.62 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |