C23H28N2O3 — CID 43003960
N-[2-(2,3-dimethoxyphenyl)-2-(1H-indol-3-yl)ethyl]pentanamide (PubChem CID 43003960) has the molecular formula C23H28N2O3 and a molecular weight of 380.49 g/mol. Its IUPAC name is N-[2-(2,3-dimethoxyphenyl)-2-(1H-indol-3-yl)ethyl]pentanamide.
| Compound Name | N-[2-(2,3-dimethoxyphenyl)-2-(1H-indol-3-yl)ethyl]pentanamide |
|---|---|
| PubChem CID | 43003960 |
| Molecular Formula | C23H28N2O3 |
| Molecular Weight | 380.49 g/mol |
| Exact Mass | 380.21 |
| IUPAC Name | N-[2-(2,3-dimethoxyphenyl)-2-(1H-indol-3-yl)ethyl]pentanamide |
| SMILES | CCCCC(=O)NCC(c1cccc(OC)c1OC)c1c[nH]c2ccccc12 |
| InChI | InChI=1S/C23H28N2O3/c1-4-5-13-22(26)25-15-19(17-10-8-12-21(27-2)23(17)28-3)18-14-24-20-11-7-6-9-16(18)20/h6-12,14,19,24H,4-5,13,15H2,1-3H3,(H,25,26) |
| InChIKey | NUMCFYGRVTVNID-UHFFFAOYSA-N |
| XLogP | 4.62 |
| TPSA | 63.35 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.49 |
| LogP ≤ 5 | 4.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |