C27H34N2O3 — CID 43003981
3-cyclohexyl-N-[2-(2,3-dimethoxyphenyl)-2-(1H-indol-3-yl)ethyl]propanamide (PubChem CID 43003981) has the molecular formula C27H34N2O3 and a molecular weight of 434.58 g/mol. Its IUPAC name is 3-cyclohexyl-N-[2-(2,3-dimethoxyphenyl)-2-(1H-indol-3-yl)ethyl]propanamide.
| Compound Name | 3-cyclohexyl-N-[2-(2,3-dimethoxyphenyl)-2-(1H-indol-3-yl)ethyl]propanamide |
|---|---|
| PubChem CID | 43003981 |
| Molecular Formula | C27H34N2O3 |
| Molecular Weight | 434.58 g/mol |
| Exact Mass | 434.26 |
| IUPAC Name | 3-cyclohexyl-N-[2-(2,3-dimethoxyphenyl)-2-(1H-indol-3-yl)ethyl]propanamide |
| SMILES | COc1cccc(C(CNC(=O)CCC2CCCCC2)c2c[nH]c3ccccc23)c1OC |
| InChI | InChI=1S/C27H34N2O3/c1-31-25-14-8-12-21(27(25)32-2)23(22-17-28-24-13-7-6-11-20(22)24)18-29-26(30)16-15-19-9-4-3-5-10-19/h6-8,11-14,17,19,23,28H,3-5,9-10,15-16,18H2,1-2H3,(H,29,30) |
| InChIKey | IRYYYSJKVWRZCE-UHFFFAOYSA-N |
| XLogP | 5.79 |
| TPSA | 63.35 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.58 |
| LogP ≤ 5 | 5.79 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |