C24H28N2O3 — CID 51158225
N-[2-(2,3-dimethoxyphenyl)-2-(1H-indol-3-yl)ethyl]cyclopentanecarboxamide (PubChem CID 51158225) has the molecular formula C24H28N2O3 and a molecular weight of 392.50 g/mol. Its IUPAC name is N-[2-(2,3-dimethoxyphenyl)-2-(1H-indol-3-yl)ethyl]cyclopentanecarboxamide.
| Compound Name | N-[2-(2,3-dimethoxyphenyl)-2-(1H-indol-3-yl)ethyl]cyclopentanecarboxamide |
|---|---|
| PubChem CID | 51158225 |
| Molecular Formula | C24H28N2O3 |
| Molecular Weight | 392.50 g/mol |
| Exact Mass | 392.21 |
| IUPAC Name | N-[2-(2,3-dimethoxyphenyl)-2-(1H-indol-3-yl)ethyl]cyclopentanecarboxamide |
| SMILES | COc1cccc(C(CNC(=O)C2CCCC2)c2c[nH]c3ccccc23)c1OC |
| InChI | InChI=1S/C24H28N2O3/c1-28-22-13-7-11-18(23(22)29-2)20(15-26-24(27)16-8-3-4-9-16)19-14-25-21-12-6-5-10-17(19)21/h5-7,10-14,16,20,25H,3-4,8-9,15H2,1-2H3,(H,26,27) |
| InChIKey | NWGLNVAMFTVMMP-UHFFFAOYSA-N |
| XLogP | 4.62 |
| TPSA | 63.35 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.50 |
| LogP ≤ 5 | 4.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |