C25H31N3O2S — CID 46800445
1-cyclohexyl-3-[2-(2,3-dimethoxyphenyl)-2-(1H-indol-3-yl)ethyl]thiourea (PubChem CID 46800445) has the molecular formula C25H31N3O2S and a molecular weight of 437.61 g/mol. Its IUPAC name is 1-cyclohexyl-3-[2-(2,3-dimethoxyphenyl)-2-(1H-indol-3-yl)ethyl]thiourea.
| Compound Name | 1-cyclohexyl-3-[2-(2,3-dimethoxyphenyl)-2-(1H-indol-3-yl)ethyl]thiourea |
|---|---|
| PubChem CID | 46800445 |
| Molecular Formula | C25H31N3O2S |
| Molecular Weight | 437.61 g/mol |
| Exact Mass | 437.21 |
| IUPAC Name | 1-cyclohexyl-3-[2-(2,3-dimethoxyphenyl)-2-(1H-indol-3-yl)ethyl]thiourea |
| SMILES | COc1cccc(C(CNC(=S)NC2CCCCC2)c2c[nH]c3ccccc23)c1OC |
| InChI | InChI=1S/C25H31N3O2S/c1-29-23-14-8-12-19(24(23)30-2)21(20-15-26-22-13-7-6-11-18(20)22)16-27-25(31)28-17-9-4-3-5-10-17/h6-8,11-15,17,21,26H,3-5,9-10,16H2,1-2H3,(H2,27,28,31) |
| InChIKey | LZJRCDSWHMECRM-UHFFFAOYSA-N |
| XLogP | 5.11 |
| TPSA | 58.31 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 437.61 |
| LogP ≤ 5 | 5.11 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|