C23H29N3O3S — CID 42913246
1-[2-(2,3-dimethoxyphenyl)-2-(1H-indol-3-yl)ethyl]-3-(1-methoxypropan-2-yl)thiourea (PubChem CID 42913246) has the molecular formula C23H29N3O3S and a molecular weight of 427.57 g/mol. Its IUPAC name is 1-[2-(2,3-dimethoxyphenyl)-2-(1H-indol-3-yl)ethyl]-3-(1-methoxypropan-2-yl)thiourea.
| Compound Name | 1-[2-(2,3-dimethoxyphenyl)-2-(1H-indol-3-yl)ethyl]-3-(1-methoxypropan-2-yl)thiourea |
|---|---|
| PubChem CID | 42913246 |
| Molecular Formula | C23H29N3O3S |
| Molecular Weight | 427.57 g/mol |
| Exact Mass | 427.19 |
| IUPAC Name | 1-[2-(2,3-dimethoxyphenyl)-2-(1H-indol-3-yl)ethyl]-3-(1-methoxypropan-2-yl)thiourea |
| SMILES | COCC(C)NC(=S)NCC(c1cccc(OC)c1OC)c1c[nH]c2ccccc12 |
| InChI | InChI=1S/C23H29N3O3S/c1-15(14-27-2)26-23(30)25-13-19(17-9-7-11-21(28-3)22(17)29-4)18-12-24-20-10-6-5-8-16(18)20/h5-12,15,19,24H,13-14H2,1-4H3,(H2,25,26,30) |
| InChIKey | USQITYHTFRBVAH-UHFFFAOYSA-N |
| XLogP | 3.82 |
| TPSA | 67.54 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 427.57 |
| LogP ≤ 5 | 3.82 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|