C23H31N4O2S+ — CID 8770205
2-[[(2R)-2-(2,3-dimethoxyphenyl)-2-(1H-indol-3-yl)ethyl]carbamothioylamino]ethyl-dimethylazanium (PubChem CID 8770205) has the molecular formula C23H31N4O2S+ and a molecular weight of 427.59 g/mol. Its IUPAC name is 2-[[(2R)-2-(2,3-dimethoxyphenyl)-2-(1H-indol-3-yl)ethyl]carbamothioylamino]ethyl-dimethylazanium.
| Compound Name | 2-[[(2R)-2-(2,3-dimethoxyphenyl)-2-(1H-indol-3-yl)ethyl]carbamothioylamino]ethyl-dimethylazanium |
|---|---|
| PubChem CID | 8770205 |
| Molecular Formula | C23H31N4O2S+ |
| Molecular Weight | 427.59 g/mol |
| Exact Mass | 427.22 |
| IUPAC Name | 2-[[(2R)-2-(2,3-dimethoxyphenyl)-2-(1H-indol-3-yl)ethyl]carbamothioylamino]ethyl-dimethylazanium |
| SMILES | COc1cccc([C@H](CNC(=S)NCC[NH+](C)C)c2c[nH]c3ccccc23)c1OC |
| InChI | InChI=1S/C23H30N4O2S/c1-27(2)13-12-24-23(30)26-15-19(17-9-7-11-21(28-3)22(17)29-4)18-14-25-20-10-6-5-8-16(18)20/h5-11,14,19,25H,12-13,15H2,1-4H3,(H2,24,26,30)/p+1/t19-/m0/s1 |
| InChIKey | MIAGEJAIKWVXBH-IBGZPJMESA-O |
| XLogP | 1.93 |
| TPSA | 62.75 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 427.59 |
| LogP ≤ 5 | 1.93 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|