C24H24N2O4S — CID 41090894
N-[(2S)-2-(2,3-dimethoxyphenyl)-2-(1H-indol-3-yl)ethyl]benzenesulfonamide (PubChem CID 41090894) has the molecular formula C24H24N2O4S and a molecular weight of 436.53 g/mol. Its IUPAC name is N-[(2S)-2-(2,3-dimethoxyphenyl)-2-(1H-indol-3-yl)ethyl]benzenesulfonamide.
| Compound Name | N-[(2S)-2-(2,3-dimethoxyphenyl)-2-(1H-indol-3-yl)ethyl]benzenesulfonamide |
|---|---|
| PubChem CID | 41090894 |
| Molecular Formula | C24H24N2O4S |
| Molecular Weight | 436.53 g/mol |
| Exact Mass | 436.15 |
| IUPAC Name | N-[(2S)-2-(2,3-dimethoxyphenyl)-2-(1H-indol-3-yl)ethyl]benzenesulfonamide |
| SMILES | COc1cccc([C@@H](CNS(=O)(=O)c2ccccc2)c2c[nH]c3ccccc23)c1OC |
| InChI | InChI=1S/C24H24N2O4S/c1-29-23-14-8-12-19(24(23)30-2)21(20-15-25-22-13-7-6-11-18(20)22)16-26-31(27,28)17-9-4-3-5-10-17/h3-15,21,25-26H,16H2,1-2H3/t21-/m1/s1 |
| InChIKey | NDUUEYSGJNYZRV-OAQYLSRUSA-N |
| XLogP | 4.30 |
| TPSA | 80.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.53 |
| LogP ≤ 5 | 4.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |