C24H20F2N2O2 — CID 43018386
2,5-difluoro-N-[2-(1H-indol-3-yl)-2-(4-methoxyphenyl)ethyl]benzamide (PubChem CID 43018386) has the molecular formula C24H20F2N2O2 and a molecular weight of 406.43 g/mol. Its IUPAC name is 2,5-difluoro-N-[2-(1H-indol-3-yl)-2-(4-methoxyphenyl)ethyl]benzamide.
| Compound Name | 2,5-difluoro-N-[2-(1H-indol-3-yl)-2-(4-methoxyphenyl)ethyl]benzamide |
|---|---|
| PubChem CID | 43018386 |
| Molecular Formula | C24H20F2N2O2 |
| Molecular Weight | 406.43 g/mol |
| Exact Mass | 406.15 |
| IUPAC Name | 2,5-difluoro-N-[2-(1H-indol-3-yl)-2-(4-methoxyphenyl)ethyl]benzamide |
| SMILES | COc1ccc(C(CNC(=O)c2cc(F)ccc2F)c2c[nH]c3ccccc23)cc1 |
| InChI | InChI=1S/C24H20F2N2O2/c1-30-17-9-6-15(7-10-17)20(21-14-27-23-5-3-2-4-18(21)23)13-28-24(29)19-12-16(25)8-11-22(19)26/h2-12,14,20,27H,13H2,1H3,(H,28,29) |
| InChIKey | ZSYHDIRASQNWRL-UHFFFAOYSA-N |
| XLogP | 5.02 |
| TPSA | 54.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.43 |
| LogP ≤ 5 | 5.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |