C24H21F2N3O — CID 50801431
1-[2-(4-fluorophenyl)-2-(1H-indol-3-yl)ethyl]-3-[(4-fluorophenyl)methyl]urea (PubChem CID 50801431) has the molecular formula C24H21F2N3O and a molecular weight of 405.45 g/mol. Its IUPAC name is 1-[2-(4-fluorophenyl)-2-(1H-indol-3-yl)ethyl]-3-[(4-fluorophenyl)methyl]urea.
| Compound Name | 1-[2-(4-fluorophenyl)-2-(1H-indol-3-yl)ethyl]-3-[(4-fluorophenyl)methyl]urea |
|---|---|
| PubChem CID | 50801431 |
| Molecular Formula | C24H21F2N3O |
| Molecular Weight | 405.45 g/mol |
| Exact Mass | 405.17 |
| IUPAC Name | 1-[2-(4-fluorophenyl)-2-(1H-indol-3-yl)ethyl]-3-[(4-fluorophenyl)methyl]urea |
| SMILES | O=C(NCc1ccc(F)cc1)NCC(c1ccc(F)cc1)c1c[nH]c2ccccc12 |
| InChI | InChI=1S/C24H21F2N3O/c25-18-9-5-16(6-10-18)13-28-24(30)29-14-21(17-7-11-19(26)12-8-17)22-15-27-23-4-2-1-3-20(22)23/h1-12,15,21,27H,13-14H2,(H2,28,29,30) |
| InChIKey | ISSBBYHCLIFJHE-UHFFFAOYSA-N |
| XLogP | 5.08 |
| TPSA | 56.92 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.45 |
| LogP ≤ 5 | 5.08 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 1 |