C32H30FN3O2 — CID 2118838
N-[(2S)-2-[4-(dimethylamino)phenyl]-2-(1H-indol-3-yl)ethyl]-2-[(4-fluorophenyl)methoxy]benzamide (PubChem CID 2118838) has the molecular formula C32H30FN3O2 and a molecular weight of 507.61 g/mol. Its IUPAC name is N-[(2S)-2-[4-(dimethylamino)phenyl]-2-(1H-indol-3-yl)ethyl]-2-[(4-fluorophenyl)methoxy]benzamide.
| Compound Name | N-[(2S)-2-[4-(dimethylamino)phenyl]-2-(1H-indol-3-yl)ethyl]-2-[(4-fluorophenyl)methoxy]benzamide |
|---|---|
| PubChem CID | 2118838 |
| Molecular Formula | C32H30FN3O2 |
| Molecular Weight | 507.61 g/mol |
| Exact Mass | 507.23 |
| IUPAC Name | N-[(2S)-2-[4-(dimethylamino)phenyl]-2-(1H-indol-3-yl)ethyl]-2-[(4-fluorophenyl)methoxy]benzamide |
| SMILES | CN(C)c1ccc([C@H](CNC(=O)c2ccccc2OCc2ccc(F)cc2)c2c[nH]c3ccccc23)cc1 |
| InChI | InChI=1S/C32H30FN3O2/c1-36(2)25-17-13-23(14-18-25)28(29-20-34-30-9-5-3-7-26(29)30)19-35-32(37)27-8-4-6-10-31(27)38-21-22-11-15-24(33)16-12-22/h3-18,20,28,34H,19,21H2,1-2H3,(H,35,37)/t28-/m0/s1 |
| InChIKey | DPNKAVUCSLGLSY-NDEPHWFRSA-N |
| XLogP | 6.51 |
| TPSA | 57.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 507.61 |
| LogP ≤ 5 | 6.51 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'} |
|---|