C28H30N4O2 — CID 41084156
2-(4-acetamidophenyl)-N-[(2R)-2-[4-(dimethylamino)phenyl]-2-(1H-indol-3-yl)ethyl]acetamide (PubChem CID 41084156) has the molecular formula C28H30N4O2 and a molecular weight of 454.57 g/mol. Its IUPAC name is 2-(4-acetamidophenyl)-N-[(2R)-2-[4-(dimethylamino)phenyl]-2-(1H-indol-3-yl)ethyl]acetamide.
| Compound Name | 2-(4-acetamidophenyl)-N-[(2R)-2-[4-(dimethylamino)phenyl]-2-(1H-indol-3-yl)ethyl]acetamide |
|---|---|
| PubChem CID | 41084156 |
| Molecular Formula | C28H30N4O2 |
| Molecular Weight | 454.57 g/mol |
| Exact Mass | 454.24 |
| IUPAC Name | 2-(4-acetamidophenyl)-N-[(2R)-2-[4-(dimethylamino)phenyl]-2-(1H-indol-3-yl)ethyl]acetamide |
| SMILES | CC(=O)Nc1ccc(CC(=O)NC[C@H](c2ccc(N(C)C)cc2)c2c[nH]c3ccccc23)cc1 |
| InChI | InChI=1S/C28H30N4O2/c1-19(33)31-22-12-8-20(9-13-22)16-28(34)30-17-25(21-10-14-23(15-11-21)32(2)3)26-18-29-27-7-5-4-6-24(26)27/h4-15,18,25,29H,16-17H2,1-3H3,(H,30,34)(H,31,33)/t25-/m1/s1 |
| InChIKey | NOJHNVWXKCAMMU-RUZDIDTESA-N |
| XLogP | 4.68 |
| TPSA | 77.23 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 454.57 |
| LogP ≤ 5 | 4.68 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'} |
|---|