C28H26N4O2 — CID 26918563
N-[(2R)-2-[4-(dimethylamino)phenyl]-2-(1H-indol-3-yl)ethyl]-2-oxo-1H-quinoline-4-carboxamide (PubChem CID 26918563) has the molecular formula C28H26N4O2 and a molecular weight of 450.54 g/mol. Its IUPAC name is N-[(2R)-2-[4-(dimethylamino)phenyl]-2-(1H-indol-3-yl)ethyl]-2-oxo-1H-quinoline-4-carboxamide.
| Compound Name | N-[(2R)-2-[4-(dimethylamino)phenyl]-2-(1H-indol-3-yl)ethyl]-2-oxo-1H-quinoline-4-carboxamide |
|---|---|
| PubChem CID | 26918563 |
| Molecular Formula | C28H26N4O2 |
| Molecular Weight | 450.54 g/mol |
| Exact Mass | 450.21 |
| IUPAC Name | N-[(2R)-2-[4-(dimethylamino)phenyl]-2-(1H-indol-3-yl)ethyl]-2-oxo-1H-quinoline-4-carboxamide |
| SMILES | CN(C)c1ccc([C@@H](CNC(=O)c2cc(=O)[nH]c3ccccc23)c2c[nH]c3ccccc23)cc1 |
| InChI | InChI=1S/C28H26N4O2/c1-32(2)19-13-11-18(12-14-19)23(24-17-29-25-9-5-3-8-21(24)25)16-30-28(34)22-15-27(33)31-26-10-6-4-7-20(22)26/h3-15,17,23,29H,16H2,1-2H3,(H,30,34)(H,31,33)/t23-/m1/s1 |
| InChIKey | MQMLWSQABHOONA-HSZRJFAPSA-N |
| XLogP | 4.64 |
| TPSA | 80.99 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 450.54 |
| LogP ≤ 5 | 4.64 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'} |
|---|