C25H23ClN4O3 — CID 40943129
2-chloro-N-[(2S)-2-[4-(dimethylamino)phenyl]-2-(1H-indol-3-yl)ethyl]-4-nitrobenzamide (PubChem CID 40943129) has the molecular formula C25H23ClN4O3 and a molecular weight of 462.94 g/mol. Its IUPAC name is 2-chloro-N-[(2S)-2-[4-(dimethylamino)phenyl]-2-(1H-indol-3-yl)ethyl]-4-nitrobenzamide.
| Compound Name | 2-chloro-N-[(2S)-2-[4-(dimethylamino)phenyl]-2-(1H-indol-3-yl)ethyl]-4-nitrobenzamide |
|---|---|
| PubChem CID | 40943129 |
| Molecular Formula | C25H23ClN4O3 |
| Molecular Weight | 462.94 g/mol |
| Exact Mass | 462.15 |
| IUPAC Name | 2-chloro-N-[(2S)-2-[4-(dimethylamino)phenyl]-2-(1H-indol-3-yl)ethyl]-4-nitrobenzamide |
| SMILES | CN(C)c1ccc([C@H](CNC(=O)c2ccc([N+](=O)[O-])cc2Cl)c2c[nH]c3ccccc23)cc1 |
| InChI | InChI=1S/C25H23ClN4O3/c1-29(2)17-9-7-16(8-10-17)21(22-15-27-24-6-4-3-5-19(22)24)14-28-25(31)20-12-11-18(30(32)33)13-23(20)26/h3-13,15,21,27H,14H2,1-2H3,(H,28,31)/t21-/m0/s1 |
| InChIKey | KJCNIYAAQOJHQD-NRFANRHFSA-N |
| XLogP | 5.36 |
| TPSA | 91.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 462.94 |
| LogP ≤ 5 | 5.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|