C23H25Cl2N3O — CID 43005305
2,2-dichloro-N-[2-[4-(dimethylamino)phenyl]-2-(1H-indol-3-yl)ethyl]-1-methylcyclopropane-1-carboxamide (PubChem CID 43005305) has the molecular formula C23H25Cl2N3O and a molecular weight of 430.38 g/mol. Its IUPAC name is 2,2-dichloro-N-[2-[4-(dimethylamino)phenyl]-2-(1H-indol-3-yl)ethyl]-1-methylcyclopropane-1-carboxamide.
| Compound Name | 2,2-dichloro-N-[2-[4-(dimethylamino)phenyl]-2-(1H-indol-3-yl)ethyl]-1-methylcyclopropane-1-carboxamide |
|---|---|
| PubChem CID | 43005305 |
| Molecular Formula | C23H25Cl2N3O |
| Molecular Weight | 430.38 g/mol |
| Exact Mass | 429.14 |
| IUPAC Name | 2,2-dichloro-N-[2-[4-(dimethylamino)phenyl]-2-(1H-indol-3-yl)ethyl]-1-methylcyclopropane-1-carboxamide |
| SMILES | CN(C)c1ccc(C(CNC(=O)C2(C)CC2(Cl)Cl)c2c[nH]c3ccccc23)cc1 |
| InChI | InChI=1S/C23H25Cl2N3O/c1-22(14-23(22,24)25)21(29)27-12-18(15-8-10-16(11-9-15)28(2)3)19-13-26-20-7-5-4-6-17(19)20/h4-11,13,18,26H,12,14H2,1-3H3,(H,27,29) |
| InChIKey | HWXFOWKAPSJQIW-UHFFFAOYSA-N |
| XLogP | 5.07 |
| TPSA | 48.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.38 |
| LogP ≤ 5 | 5.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|