C24H25N3OS — CID 43004910
N-[2-[4-(dimethylamino)phenyl]-2-(1H-indol-3-yl)ethyl]-3-methylthiophene-2-carboxamide (PubChem CID 43004910) has the molecular formula C24H25N3OS and a molecular weight of 403.55 g/mol. Its IUPAC name is N-[2-[4-(dimethylamino)phenyl]-2-(1H-indol-3-yl)ethyl]-3-methylthiophene-2-carboxamide.
| Compound Name | N-[2-[4-(dimethylamino)phenyl]-2-(1H-indol-3-yl)ethyl]-3-methylthiophene-2-carboxamide |
|---|---|
| PubChem CID | 43004910 |
| Molecular Formula | C24H25N3OS |
| Molecular Weight | 403.55 g/mol |
| Exact Mass | 403.17 |
| IUPAC Name | N-[2-[4-(dimethylamino)phenyl]-2-(1H-indol-3-yl)ethyl]-3-methylthiophene-2-carboxamide |
| SMILES | Cc1ccsc1C(=O)NCC(c1ccc(N(C)C)cc1)c1c[nH]c2ccccc12 |
| InChI | InChI=1S/C24H25N3OS/c1-16-12-13-29-23(16)24(28)26-14-20(17-8-10-18(11-9-17)27(2)3)21-15-25-22-7-5-4-6-19(21)22/h4-13,15,20,25H,14H2,1-3H3,(H,26,28) |
| InChIKey | PHKGIONHBOVDPA-UHFFFAOYSA-N |
| XLogP | 5.17 |
| TPSA | 48.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.55 |
| LogP ≤ 5 | 5.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'} |
|---|