C27H30N4O3S — CID 3461746
N-[2-[4-(dimethylamino)phenyl]-2-(1H-indol-3-yl)ethyl]-4-(dimethylsulfamoyl)benzamide (PubChem CID 3461746) has the molecular formula C27H30N4O3S and a molecular weight of 490.63 g/mol. Its IUPAC name is N-[2-[4-(dimethylamino)phenyl]-2-(1H-indol-3-yl)ethyl]-4-(dimethylsulfamoyl)benzamide.
| Compound Name | N-[2-[4-(dimethylamino)phenyl]-2-(1H-indol-3-yl)ethyl]-4-(dimethylsulfamoyl)benzamide |
|---|---|
| PubChem CID | 3461746 |
| Molecular Formula | C27H30N4O3S |
| Molecular Weight | 490.63 g/mol |
| Exact Mass | 490.20 |
| IUPAC Name | N-[2-[4-(dimethylamino)phenyl]-2-(1H-indol-3-yl)ethyl]-4-(dimethylsulfamoyl)benzamide |
| SMILES | CN(C)c1ccc(C(CNC(=O)c2ccc(S(=O)(=O)N(C)C)cc2)c2c[nH]c3ccccc23)cc1 |
| InChI | InChI=1S/C27H30N4O3S/c1-30(2)21-13-9-19(10-14-21)24(25-18-28-26-8-6-5-7-23(25)26)17-29-27(32)20-11-15-22(16-12-20)35(33,34)31(3)4/h5-16,18,24,28H,17H2,1-4H3,(H,29,32) |
| InChIKey | JFGSIRWRJPTQJL-UHFFFAOYSA-N |
| XLogP | 4.05 |
| TPSA | 85.51 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 490.63 |
| LogP ≤ 5 | 4.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'} |
|---|