C26H25N3O2 — CID 46692237
4-(acetamidomethyl)-N-[2-(1H-indol-3-yl)-2-phenylethyl]benzamide (PubChem CID 46692237) has the molecular formula C26H25N3O2 and a molecular weight of 411.51 g/mol. Its IUPAC name is 4-(acetamidomethyl)-N-[2-(1H-indol-3-yl)-2-phenylethyl]benzamide.
| Compound Name | 4-(acetamidomethyl)-N-[2-(1H-indol-3-yl)-2-phenylethyl]benzamide |
|---|---|
| PubChem CID | 46692237 |
| Molecular Formula | C26H25N3O2 |
| Molecular Weight | 411.51 g/mol |
| Exact Mass | 411.19 |
| IUPAC Name | 4-(acetamidomethyl)-N-[2-(1H-indol-3-yl)-2-phenylethyl]benzamide |
| SMILES | CC(=O)NCc1ccc(C(=O)NCC(c2ccccc2)c2c[nH]c3ccccc23)cc1 |
| InChI | InChI=1S/C26H25N3O2/c1-18(30)27-15-19-11-13-21(14-12-19)26(31)29-16-23(20-7-3-2-4-8-20)24-17-28-25-10-6-5-9-22(24)25/h2-14,17,23,28H,15-16H2,1H3,(H,27,30)(H,29,31) |
| InChIKey | CKWGYWCJIKKBKL-UHFFFAOYSA-N |
| XLogP | 4.37 |
| TPSA | 73.99 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.51 |
| LogP ≤ 5 | 4.37 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |