C22H17Cl2N3O — CID 55341798
2-chloro-N-[2-(2-chlorophenyl)-2-(1H-indol-3-yl)ethyl]pyridine-3-carboxamide (PubChem CID 55341798) has the molecular formula C22H17Cl2N3O and a molecular weight of 410.30 g/mol. Its IUPAC name is 2-chloro-N-[2-(2-chlorophenyl)-2-(1H-indol-3-yl)ethyl]pyridine-3-carboxamide.
| Compound Name | 2-chloro-N-[2-(2-chlorophenyl)-2-(1H-indol-3-yl)ethyl]pyridine-3-carboxamide |
|---|---|
| PubChem CID | 55341798 |
| Molecular Formula | C22H17Cl2N3O |
| Molecular Weight | 410.30 g/mol |
| Exact Mass | 409.07 |
| IUPAC Name | 2-chloro-N-[2-(2-chlorophenyl)-2-(1H-indol-3-yl)ethyl]pyridine-3-carboxamide |
| SMILES | O=C(NCC(c1ccccc1Cl)c1c[nH]c2ccccc12)c1cccnc1Cl |
| InChI | InChI=1S/C22H17Cl2N3O/c23-19-9-3-1-6-14(19)17(18-12-26-20-10-4-2-7-15(18)20)13-27-22(28)16-8-5-11-25-21(16)24/h1-12,17,26H,13H2,(H,27,28) |
| InChIKey | BLIRMIKRLRTJKL-UHFFFAOYSA-N |
| XLogP | 5.43 |
| TPSA | 57.78 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.30 |
| LogP ≤ 5 | 5.43 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|