C27H23ClN4O3 — CID 46520082
N-[2-(2-chlorophenyl)-2-(1H-indol-3-yl)ethyl]-4-[(2,5-dioxoimidazolidin-1-yl)methyl]benzamide (PubChem CID 46520082) has the molecular formula C27H23ClN4O3 and a molecular weight of 486.96 g/mol. Its IUPAC name is N-[2-(2-chlorophenyl)-2-(1H-indol-3-yl)ethyl]-4-[(2,5-dioxoimidazolidin-1-yl)methyl]benzamide.
| Compound Name | N-[2-(2-chlorophenyl)-2-(1H-indol-3-yl)ethyl]-4-[(2,5-dioxoimidazolidin-1-yl)methyl]benzamide |
|---|---|
| PubChem CID | 46520082 |
| Molecular Formula | C27H23ClN4O3 |
| Molecular Weight | 486.96 g/mol |
| Exact Mass | 486.15 |
| IUPAC Name | N-[2-(2-chlorophenyl)-2-(1H-indol-3-yl)ethyl]-4-[(2,5-dioxoimidazolidin-1-yl)methyl]benzamide |
| SMILES | O=C(NCC(c1ccccc1Cl)c1c[nH]c2ccccc12)c1ccc(CN2C(=O)CNC2=O)cc1 |
| InChI | InChI=1S/C27H23ClN4O3/c28-23-7-3-1-5-19(23)21(22-13-29-24-8-4-2-6-20(22)24)14-30-26(34)18-11-9-17(10-12-18)16-32-25(33)15-31-27(32)35/h1-13,21,29H,14-16H2,(H,30,34)(H,31,35) |
| InChIKey | SPFDRERWCSFZLB-UHFFFAOYSA-N |
| XLogP | 4.43 |
| TPSA | 94.30 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 486.96 |
| LogP ≤ 5 | 4.43 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|