C23H23ClN4O3 — CID 78802980
N-[2-(2-chlorophenyl)-2-(1H-indol-3-yl)ethyl]-4-(2,5-dioxoimidazolidin-1-yl)butanamide (PubChem CID 78802980) has the molecular formula C23H23ClN4O3 and a molecular weight of 438.92 g/mol. Its IUPAC name is N-[2-(2-chlorophenyl)-2-(1H-indol-3-yl)ethyl]-4-(2,5-dioxoimidazolidin-1-yl)butanamide.
| Compound Name | N-[2-(2-chlorophenyl)-2-(1H-indol-3-yl)ethyl]-4-(2,5-dioxoimidazolidin-1-yl)butanamide |
|---|---|
| PubChem CID | 78802980 |
| Molecular Formula | C23H23ClN4O3 |
| Molecular Weight | 438.92 g/mol |
| Exact Mass | 438.15 |
| IUPAC Name | N-[2-(2-chlorophenyl)-2-(1H-indol-3-yl)ethyl]-4-(2,5-dioxoimidazolidin-1-yl)butanamide |
| SMILES | O=C(CCCN1C(=O)CNC1=O)NCC(c1ccccc1Cl)c1c[nH]c2ccccc12 |
| InChI | InChI=1S/C23H23ClN4O3/c24-19-8-3-1-6-15(19)17(18-12-25-20-9-4-2-7-16(18)20)13-26-21(29)10-5-11-28-22(30)14-27-23(28)31/h1-4,6-9,12,17,25H,5,10-11,13-14H2,(H,26,29)(H,27,31) |
| InChIKey | VJSJXKDTZXAPJK-UHFFFAOYSA-N |
| XLogP | 3.40 |
| TPSA | 94.30 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.92 |
| LogP ≤ 5 | 3.40 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|