C22H23ClN2O3 — CID 42911057
ethyl 4-[[2-(2-chlorophenyl)-2-(1H-indol-3-yl)ethyl]amino]-4-oxobutanoate (PubChem CID 42911057) has the molecular formula C22H23ClN2O3 and a molecular weight of 398.89 g/mol. Its IUPAC name is ethyl 4-[[2-(2-chlorophenyl)-2-(1H-indol-3-yl)ethyl]amino]-4-oxobutanoate.
| Compound Name | ethyl 4-[[2-(2-chlorophenyl)-2-(1H-indol-3-yl)ethyl]amino]-4-oxobutanoate |
|---|---|
| PubChem CID | 42911057 |
| Molecular Formula | C22H23ClN2O3 |
| Molecular Weight | 398.89 g/mol |
| Exact Mass | 398.14 |
| IUPAC Name | ethyl 4-[[2-(2-chlorophenyl)-2-(1H-indol-3-yl)ethyl]amino]-4-oxobutanoate |
| SMILES | CCOC(=O)CCC(=O)NCC(c1ccccc1Cl)c1c[nH]c2ccccc12 |
| InChI | InChI=1S/C22H23ClN2O3/c1-2-28-22(27)12-11-21(26)25-14-17(15-7-3-5-9-19(15)23)18-13-24-20-10-6-4-8-16(18)20/h3-10,13,17,24H,2,11-12,14H2,1H3,(H,25,26) |
| InChIKey | CVFUKBZSEYZHIL-UHFFFAOYSA-N |
| XLogP | 4.41 |
| TPSA | 71.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.89 |
| LogP ≤ 5 | 4.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |