C26H26ClN3O3S — CID 134028769
N-[2-(2-chlorophenyl)-2-(1H-indol-3-yl)ethyl]-3-[4-(methylsulfamoyl)phenyl]propanamide (PubChem CID 134028769) has the molecular formula C26H26ClN3O3S and a molecular weight of 496.03 g/mol. Its IUPAC name is N-[2-(2-chlorophenyl)-2-(1H-indol-3-yl)ethyl]-3-[4-(methylsulfamoyl)phenyl]propanamide.
| Compound Name | N-[2-(2-chlorophenyl)-2-(1H-indol-3-yl)ethyl]-3-[4-(methylsulfamoyl)phenyl]propanamide |
|---|---|
| PubChem CID | 134028769 |
| Molecular Formula | C26H26ClN3O3S |
| Molecular Weight | 496.03 g/mol |
| Exact Mass | 495.14 |
| IUPAC Name | N-[2-(2-chlorophenyl)-2-(1H-indol-3-yl)ethyl]-3-[4-(methylsulfamoyl)phenyl]propanamide |
| SMILES | CNS(=O)(=O)c1ccc(CCC(=O)NCC(c2ccccc2Cl)c2c[nH]c3ccccc23)cc1 |
| InChI | InChI=1S/C26H26ClN3O3S/c1-28-34(32,33)19-13-10-18(11-14-19)12-15-26(31)30-17-22(20-6-2-4-8-24(20)27)23-16-29-25-9-5-3-7-21(23)25/h2-11,13-14,16,22,28-29H,12,15,17H2,1H3,(H,30,31) |
| InChIKey | XQDIVKDFBPTSHQ-UHFFFAOYSA-N |
| XLogP | 4.61 |
| TPSA | 91.06 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 496.03 |
| LogP ≤ 5 | 4.61 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |