C24H19ClN2O6S — CID 42933242
5-[[2-(2-chlorophenyl)-2-(1H-indol-3-yl)ethyl]sulfamoyl]benzene-1,3-dicarboxylic acid (PubChem CID 42933242) has the molecular formula C24H19ClN2O6S and a molecular weight of 498.94 g/mol. Its IUPAC name is 5-[[2-(2-chlorophenyl)-2-(1H-indol-3-yl)ethyl]sulfamoyl]benzene-1,3-dicarboxylic acid.
| Compound Name | 5-[[2-(2-chlorophenyl)-2-(1H-indol-3-yl)ethyl]sulfamoyl]benzene-1,3-dicarboxylic acid |
|---|---|
| PubChem CID | 42933242 |
| Molecular Formula | C24H19ClN2O6S |
| Molecular Weight | 498.94 g/mol |
| Exact Mass | 498.07 |
| IUPAC Name | 5-[[2-(2-chlorophenyl)-2-(1H-indol-3-yl)ethyl]sulfamoyl]benzene-1,3-dicarboxylic acid |
| SMILES | O=C(O)c1cc(C(=O)O)cc(S(=O)(=O)NCC(c2ccccc2Cl)c2c[nH]c3ccccc23)c1 |
| InChI | InChI=1S/C24H19ClN2O6S/c25-21-7-3-1-5-17(21)20(19-12-26-22-8-4-2-6-18(19)22)13-27-34(32,33)16-10-14(23(28)29)9-15(11-16)24(30)31/h1-12,20,26-27H,13H2,(H,28,29)(H,30,31) |
| InChIKey | YSLVGYSBGNZMHR-UHFFFAOYSA-N |
| XLogP | 4.33 |
| TPSA | 136.56 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 498.94 |
| LogP ≤ 5 | 4.33 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |