C20H21ClN4O2 — CID 8645145
(2R)-N-carbamoyl-2-[[(2S)-2-(2-chlorophenyl)-2-(1H-indol-3-yl)ethyl]amino]propanamide (PubChem CID 8645145) has the molecular formula C20H21ClN4O2 and a molecular weight of 384.87 g/mol. Its IUPAC name is (2R)-N-carbamoyl-2-[[(2S)-2-(2-chlorophenyl)-2-(1H-indol-3-yl)ethyl]amino]propanamide.
| Compound Name | (2R)-N-carbamoyl-2-[[(2S)-2-(2-chlorophenyl)-2-(1H-indol-3-yl)ethyl]amino]propanamide |
|---|---|
| PubChem CID | 8645145 |
| Molecular Formula | C20H21ClN4O2 |
| Molecular Weight | 384.87 g/mol |
| Exact Mass | 384.14 |
| IUPAC Name | (2R)-N-carbamoyl-2-[[(2S)-2-(2-chlorophenyl)-2-(1H-indol-3-yl)ethyl]amino]propanamide |
| SMILES | C[C@@H](NC[C@H](c1ccccc1Cl)c1c[nH]c2ccccc12)C(=O)NC(N)=O |
| InChI | InChI=1S/C20H21ClN4O2/c1-12(19(26)25-20(22)27)23-10-15(13-6-2-4-8-17(13)21)16-11-24-18-9-5-3-7-14(16)18/h2-9,11-12,15,23-24H,10H2,1H3,(H3,22,25,26,27)/t12-,15-/m1/s1 |
| InChIKey | QLTQZPNKNITOPU-IUODEOHRSA-N |
| XLogP | 3.13 |
| TPSA | 100.01 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.87 |
| LogP ≤ 5 | 3.13 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 3 |