C23H26ClN3O2 — CID 7910791
(2S)-2-acetamido-N-[(2S)-2-(2-chlorophenyl)-2-(1H-indol-3-yl)ethyl]-3-methylbutanamide (PubChem CID 7910791) has the molecular formula C23H26ClN3O2 and a molecular weight of 411.93 g/mol. Its IUPAC name is (2S)-2-acetamido-N-[(2S)-2-(2-chlorophenyl)-2-(1H-indol-3-yl)ethyl]-3-methylbutanamide.
| Compound Name | (2S)-2-acetamido-N-[(2S)-2-(2-chlorophenyl)-2-(1H-indol-3-yl)ethyl]-3-methylbutanamide |
|---|---|
| PubChem CID | 7910791 |
| Molecular Formula | C23H26ClN3O2 |
| Molecular Weight | 411.93 g/mol |
| Exact Mass | 411.17 |
| IUPAC Name | (2S)-2-acetamido-N-[(2S)-2-(2-chlorophenyl)-2-(1H-indol-3-yl)ethyl]-3-methylbutanamide |
| SMILES | CC(=O)N[C@H](C(=O)NC[C@H](c1ccccc1Cl)c1c[nH]c2ccccc12)C(C)C |
| InChI | InChI=1S/C23H26ClN3O2/c1-14(2)22(27-15(3)28)23(29)26-13-18(16-8-4-6-10-20(16)24)19-12-25-21-11-7-5-9-17(19)21/h4-12,14,18,22,25H,13H2,1-3H3,(H,26,29)(H,27,28)/t18-,22+/m1/s1 |
| InChIKey | RRJFQMLLLQCTPQ-GCJKJVERSA-N |
| XLogP | 4.23 |
| TPSA | 73.99 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.93 |
| LogP ≤ 5 | 4.23 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |