C19H20ClN3O — CID 8645148
(2S)-2-[[(2R)-2-(2-chlorophenyl)-2-(1H-indol-3-yl)ethyl]amino]propanamide (PubChem CID 8645148) has the molecular formula C19H20ClN3O and a molecular weight of 341.84 g/mol. Its IUPAC name is (2S)-2-[[(2R)-2-(2-chlorophenyl)-2-(1H-indol-3-yl)ethyl]amino]propanamide.
| Compound Name | (2S)-2-[[(2R)-2-(2-chlorophenyl)-2-(1H-indol-3-yl)ethyl]amino]propanamide |
|---|---|
| PubChem CID | 8645148 |
| Molecular Formula | C19H20ClN3O |
| Molecular Weight | 341.84 g/mol |
| Exact Mass | 341.13 |
| IUPAC Name | (2S)-2-[[(2R)-2-(2-chlorophenyl)-2-(1H-indol-3-yl)ethyl]amino]propanamide |
| SMILES | C[C@H](NC[C@@H](c1ccccc1Cl)c1c[nH]c2ccccc12)C(N)=O |
| InChI | InChI=1S/C19H20ClN3O/c1-12(19(21)24)22-10-15(13-6-2-4-8-17(13)20)16-11-23-18-9-5-3-7-14(16)18/h2-9,11-12,15,22-23H,10H2,1H3,(H2,21,24)/t12-,15-/m0/s1 |
| InChIKey | KAQIWLRYAWNWBK-WFASDCNBSA-N |
| XLogP | 3.42 |
| TPSA | 70.91 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.84 |
| LogP ≤ 5 | 3.42 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |