C25H30ClN3O3 — CID 55405860
tert-butyl N-[4-[[2-(2-chlorophenyl)-2-(1H-indol-3-yl)ethyl]amino]-4-oxobutyl]carbamate (PubChem CID 55405860) has the molecular formula C25H30ClN3O3 and a molecular weight of 455.99 g/mol. Its IUPAC name is tert-butyl N-[4-[[2-(2-chlorophenyl)-2-(1H-indol-3-yl)ethyl]amino]-4-oxobutyl]carbamate.
| Compound Name | tert-butyl N-[4-[[2-(2-chlorophenyl)-2-(1H-indol-3-yl)ethyl]amino]-4-oxobutyl]carbamate |
|---|---|
| PubChem CID | 55405860 |
| Molecular Formula | C25H30ClN3O3 |
| Molecular Weight | 455.99 g/mol |
| Exact Mass | 455.20 |
| IUPAC Name | tert-butyl N-[4-[[2-(2-chlorophenyl)-2-(1H-indol-3-yl)ethyl]amino]-4-oxobutyl]carbamate |
| SMILES | CC(C)(C)OC(=O)NCCCC(=O)NCC(c1ccccc1Cl)c1c[nH]c2ccccc12 |
| InChI | InChI=1S/C25H30ClN3O3/c1-25(2,3)32-24(31)27-14-8-13-23(30)29-16-19(17-9-4-6-11-21(17)26)20-15-28-22-12-7-5-10-18(20)22/h4-7,9-12,15,19,28H,8,13-14,16H2,1-3H3,(H,27,31)(H,29,30) |
| InChIKey | ORHWCKAEITXJBG-UHFFFAOYSA-N |
| XLogP | 5.37 |
| TPSA | 83.22 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 455.99 |
| LogP ≤ 5 | 5.37 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|