C21H23ClN2O2 — CID 42803966
3-(2-chlorophenyl)-3-(1H-indol-3-yl)-N-(3-methoxypropyl)propanamide (PubChem CID 42803966) has the molecular formula C21H23ClN2O2 and a molecular weight of 370.88 g/mol. Its IUPAC name is 3-(2-chlorophenyl)-3-(1H-indol-3-yl)-N-(3-methoxypropyl)propanamide.
| Compound Name | 3-(2-chlorophenyl)-3-(1H-indol-3-yl)-N-(3-methoxypropyl)propanamide |
|---|---|
| PubChem CID | 42803966 |
| Molecular Formula | C21H23ClN2O2 |
| Molecular Weight | 370.88 g/mol |
| Exact Mass | 370.14 |
| IUPAC Name | 3-(2-chlorophenyl)-3-(1H-indol-3-yl)-N-(3-methoxypropyl)propanamide |
| SMILES | COCCCNC(=O)CC(c1ccccc1Cl)c1c[nH]c2ccccc12 |
| InChI | InChI=1S/C21H23ClN2O2/c1-26-12-6-11-23-21(25)13-17(15-7-2-4-9-19(15)22)18-14-24-20-10-5-3-8-16(18)20/h2-5,7-10,14,17,24H,6,11-13H2,1H3,(H,23,25) |
| InChIKey | QLSFTUPFASFMNX-UHFFFAOYSA-N |
| XLogP | 4.50 |
| TPSA | 54.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.88 |
| LogP ≤ 5 | 4.50 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|