C21H22F2N2O2 — CID 42803946
3-(2,4-difluorophenyl)-3-(1H-indol-3-yl)-N-(3-methoxypropyl)propanamide (PubChem CID 42803946) has the molecular formula C21H22F2N2O2 and a molecular weight of 372.42 g/mol. Its IUPAC name is 3-(2,4-difluorophenyl)-3-(1H-indol-3-yl)-N-(3-methoxypropyl)propanamide.
| Compound Name | 3-(2,4-difluorophenyl)-3-(1H-indol-3-yl)-N-(3-methoxypropyl)propanamide |
|---|---|
| PubChem CID | 42803946 |
| Molecular Formula | C21H22F2N2O2 |
| Molecular Weight | 372.42 g/mol |
| Exact Mass | 372.16 |
| IUPAC Name | 3-(2,4-difluorophenyl)-3-(1H-indol-3-yl)-N-(3-methoxypropyl)propanamide |
| SMILES | COCCCNC(=O)CC(c1ccc(F)cc1F)c1c[nH]c2ccccc12 |
| InChI | InChI=1S/C21H22F2N2O2/c1-27-10-4-9-24-21(26)12-17(15-8-7-14(22)11-19(15)23)18-13-25-20-6-3-2-5-16(18)20/h2-3,5-8,11,13,17,25H,4,9-10,12H2,1H3,(H,24,26) |
| InChIKey | JOLZAWWCEUPBTR-UHFFFAOYSA-N |
| XLogP | 4.12 |
| TPSA | 54.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.42 |
| LogP ≤ 5 | 4.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|