C30H33FN2O4 — CID 4522568
3-(3,5-dimethoxyphenyl)-3-[1-[(4-fluorophenyl)methyl]indol-3-yl]-N-(3-methoxypropyl)propanamide (PubChem CID 4522568) has the molecular formula C30H33FN2O4 and a molecular weight of 504.60 g/mol. Its IUPAC name is 3-(3,5-dimethoxyphenyl)-3-[1-[(4-fluorophenyl)methyl]indol-3-yl]-N-(3-methoxypropyl)propanamide.
| Compound Name | 3-(3,5-dimethoxyphenyl)-3-[1-[(4-fluorophenyl)methyl]indol-3-yl]-N-(3-methoxypropyl)propanamide |
|---|---|
| PubChem CID | 4522568 |
| Molecular Formula | C30H33FN2O4 |
| Molecular Weight | 504.60 g/mol |
| Exact Mass | 504.24 |
| IUPAC Name | 3-(3,5-dimethoxyphenyl)-3-[1-[(4-fluorophenyl)methyl]indol-3-yl]-N-(3-methoxypropyl)propanamide |
| SMILES | COCCCNC(=O)CC(c1cc(OC)cc(OC)c1)c1cn(Cc2ccc(F)cc2)c2ccccc12 |
| InChI | InChI=1S/C30H33FN2O4/c1-35-14-6-13-32-30(34)18-27(22-15-24(36-2)17-25(16-22)37-3)28-20-33(29-8-5-4-7-26(28)29)19-21-9-11-23(31)12-10-21/h4-5,7-12,15-17,20,27H,6,13-14,18-19H2,1-3H3,(H,32,34) |
| InChIKey | RPQXDIQQBVNKOW-UHFFFAOYSA-N |
| XLogP | 5.52 |
| TPSA | 61.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 504.60 |
| LogP ≤ 5 | 5.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|