C32H38N2O3 — CID 90488594
3-(4-tert-butylphenyl)-N-(2-methoxyethyl)-3-[1-[(4-methoxyphenyl)methyl]indol-3-yl]propanamide (PubChem CID 90488594) has the molecular formula C32H38N2O3 and a molecular weight of 498.67 g/mol. Its IUPAC name is 3-(4-tert-butylphenyl)-N-(2-methoxyethyl)-3-[1-[(4-methoxyphenyl)methyl]indol-3-yl]propanamide.
| Compound Name | 3-(4-tert-butylphenyl)-N-(2-methoxyethyl)-3-[1-[(4-methoxyphenyl)methyl]indol-3-yl]propanamide |
|---|---|
| PubChem CID | 90488594 |
| Molecular Formula | C32H38N2O3 |
| Molecular Weight | 498.67 g/mol |
| Exact Mass | 498.29 |
| IUPAC Name | 3-(4-tert-butylphenyl)-N-(2-methoxyethyl)-3-[1-[(4-methoxyphenyl)methyl]indol-3-yl]propanamide |
| SMILES | COCCNC(=O)CC(c1ccc(C(C)(C)C)cc1)c1cn(Cc2ccc(OC)cc2)c2ccccc12 |
| InChI | InChI=1S/C32H38N2O3/c1-32(2,3)25-14-12-24(13-15-25)28(20-31(35)33-18-19-36-4)29-22-34(30-9-7-6-8-27(29)30)21-23-10-16-26(37-5)17-11-23/h6-17,22,28H,18-21H2,1-5H3,(H,33,35) |
| InChIKey | KVVNLLULLNNLFJ-UHFFFAOYSA-N |
| XLogP | 6.28 |
| TPSA | 52.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 498.67 |
| LogP ≤ 5 | 6.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|