C29H29F3N2O2 — CID 83287622
N-(2-methoxyethyl)-3-[1-[(4-methylphenyl)methyl]indol-3-yl]-3-[3-(trifluoromethyl)phenyl]propanamide (PubChem CID 83287622) has the molecular formula C29H29F3N2O2 and a molecular weight of 494.56 g/mol. Its IUPAC name is N-(2-methoxyethyl)-3-[1-[(4-methylphenyl)methyl]indol-3-yl]-3-[3-(trifluoromethyl)phenyl]propanamide.
| Compound Name | N-(2-methoxyethyl)-3-[1-[(4-methylphenyl)methyl]indol-3-yl]-3-[3-(trifluoromethyl)phenyl]propanamide |
|---|---|
| PubChem CID | 83287622 |
| Molecular Formula | C29H29F3N2O2 |
| Molecular Weight | 494.56 g/mol |
| Exact Mass | 494.22 |
| IUPAC Name | N-(2-methoxyethyl)-3-[1-[(4-methylphenyl)methyl]indol-3-yl]-3-[3-(trifluoromethyl)phenyl]propanamide |
| SMILES | COCCNC(=O)CC(c1cccc(C(F)(F)F)c1)c1cn(Cc2ccc(C)cc2)c2ccccc12 |
| InChI | InChI=1S/C29H29F3N2O2/c1-20-10-12-21(13-11-20)18-34-19-26(24-8-3-4-9-27(24)34)25(17-28(35)33-14-15-36-2)22-6-5-7-23(16-22)29(30,31)32/h3-13,16,19,25H,14-15,17-18H2,1-2H3,(H,33,35) |
| InChIKey | FXZFYBFHDADAGX-UHFFFAOYSA-N |
| XLogP | 6.30 |
| TPSA | 43.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 494.56 |
| LogP ≤ 5 | 6.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|