C28H25ClF4N2O2 — CID 98444613
(3S)-3-[4-chloro-3-(trifluoromethyl)phenyl]-3-[1-[(4-fluorophenyl)methyl]indol-3-yl]-N-(2-methoxyethyl)propanamide (PubChem CID 98444613) has the molecular formula C28H25ClF4N2O2 and a molecular weight of 532.97 g/mol. Its IUPAC name is (3S)-3-[4-chloro-3-(trifluoromethyl)phenyl]-3-[1-[(4-fluorophenyl)methyl]indol-3-yl]-N-(2-methoxyethyl)propanamide.
| Compound Name | (3S)-3-[4-chloro-3-(trifluoromethyl)phenyl]-3-[1-[(4-fluorophenyl)methyl]indol-3-yl]-N-(2-methoxyethyl)propanamide |
|---|---|
| PubChem CID | 98444613 |
| Molecular Formula | C28H25ClF4N2O2 |
| Molecular Weight | 532.97 g/mol |
| Exact Mass | 532.15 |
| IUPAC Name | (3S)-3-[4-chloro-3-(trifluoromethyl)phenyl]-3-[1-[(4-fluorophenyl)methyl]indol-3-yl]-N-(2-methoxyethyl)propanamide |
| SMILES | COCCNC(=O)C[C@@H](c1ccc(Cl)c(C(F)(F)F)c1)c1cn(Cc2ccc(F)cc2)c2ccccc12 |
| InChI | InChI=1S/C28H25ClF4N2O2/c1-37-13-12-34-27(36)15-22(19-8-11-25(29)24(14-19)28(31,32)33)23-17-35(26-5-3-2-4-21(23)26)16-18-6-9-20(30)10-7-18/h2-11,14,17,22H,12-13,15-16H2,1H3,(H,34,36)/t22-/m0/s1 |
| InChIKey | HSNREEXCYMJYLE-QFIPXVFZSA-N |
| XLogP | 6.79 |
| TPSA | 43.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 532.97 |
| LogP ≤ 5 | 6.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|